C24H17FN4O3S — CID 166792113
1-(3-cyanophenyl)-N-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)pyrazole-4-carboxamide (PubChem CID 166792113) has the molecular formula C24H17FN4O3S and a molecular weight of 460.49 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-cyanophenyl)-N-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166792113 |
| Molecular Formula | C24H17FN4O3S |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-(3-cyanophenyl)-N-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)pyrazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(-c2nn(-c3cccc(C#N)c3)cc2C(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H17FN4O3S/c1-33(31,32)21-10-8-17(9-11-21)23-22(24(30)27-19-6-3-5-18(25)13-19)15-29(28-23)20-7-2-4-16(12-20)14-26/h2-13,15H,1H3,(H,27,30) |
| InChIKey | PWAGMBUNQLHXHS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |