C23H18ClN3O4S — CID 166792117
1-(4-chlorophenyl)-N-(2-hydroxyphenyl)-3-(4-methylsulfonylphenyl)pyrazole-4-carboxamide (PubChem CID 166792117) has the molecular formula C23H18ClN3O4S and a molecular weight of 467.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(2-hydroxyphenyl)-3-(4-methylsulfonylphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(2-hydroxyphenyl)-3-(4-methylsulfonylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166792117 |
| Molecular Formula | C23H18ClN3O4S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(2-hydroxyphenyl)-3-(4-methylsulfonylphenyl)pyrazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(-c2nn(-c3ccc(Cl)cc3)cc2C(=O)Nc2ccccc2O)cc1 |
| InChI | InChI=1S/C23H18ClN3O4S/c1-32(30,31)18-12-6-15(7-13-18)22-19(23(29)25-20-4-2-3-5-21(20)28)14-27(26-22)17-10-8-16(24)9-11-17/h2-14,28H,1H3,(H,25,29) |
| InChIKey | CTPDAOYCWZPAQZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|