C16H12ClN3O4S — CID 52916544
3-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-4-carboxylic acid (PubChem CID 52916544) has the molecular formula C16H12ClN3O4S and a molecular weight of 377.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-4-carboxylic acid.
| Compound Name | 3-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 52916544 |
| Molecular Formula | C16H12ClN3O4S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-4-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(C(=O)O)c(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C16H12ClN3O4S/c17-11-3-1-10(2-4-11)15-14(16(21)22)9-20(19-15)12-5-7-13(8-6-12)25(18,23)24/h1-9H,(H,21,22)(H2,18,23,24) |
| InChIKey | AMGLJTTXODUYEM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |