About [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate
[3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate (PubChem CID 70280192) has the molecular formula C22H15Cl2N3O5S
and a molecular weight of 504.35 g/mol. Its IUPAC name is [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate |
| PubChem CID | 70280192 |
| Molecular Formula | C22H15Cl2N3O5S |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(-c3ccc(Cl)cc3)c(OC(=O)O)c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H15Cl2N3O5S/c23-15-5-1-13(2-6-15)19-21(32-22(28)29)20(14-3-7-16(24)8-4-14)27(26-19)17-9-11-18(12-10-17)33(25,30)31/h1-12H,(H,28,29)(H2,25,30,31) |
| InChIKey | QAERRMWRDBCPMH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate?
The IUPAC name of [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate (CID 70280192) is [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate.
What is the SMILES notation for [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate?
The canonical SMILES for [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate is NS(=O)(=O)c1ccc(-n2nc(-c3ccc(Cl)cc3)c(OC(=O)O)c2-c2ccc(Cl)cc2)cc1.
What is the InChIKey of [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate?
The InChIKey is QAERRMWRDBCPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15Cl2N3O5S/c23-15-5-1-13(2-6-15)19-21(32-22(28)29)20(14-3-7-16(24)8-4-14)27(26-19)17-9-11-18(12-10-17)33(25,30)31/h1-12H,(H,28,29)(H2,25,30,31).
What are the key properties of [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate?
[3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate has a molecular weight of 504.35 g/mol, XLogP of 5.22, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate is sourced from PubChem (CID 70280192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).