C22H15Cl2N3O5S — CID 70280192
[3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate (PubChem CID 70280192) has the molecular formula C22H15Cl2N3O5S and a molecular weight of 504.35 g/mol. Its IUPAC name is [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate.
| Compound Name | [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70280192 |
| Molecular Formula | C22H15Cl2N3O5S |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | [3,5-bis(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazol-4-yl] hydrogen carbonate |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(-c3ccc(Cl)cc3)c(OC(=O)O)c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H15Cl2N3O5S/c23-15-5-1-13(2-6-15)19-21(32-22(28)29)20(14-3-7-16(24)8-4-14)27(26-19)17-9-11-18(12-10-17)33(25,30)31/h1-12H,(H,28,29)(H2,25,30,31) |
| InChIKey | QAERRMWRDBCPMH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |