C16H13ClN4O3S — CID 173275535
4-(4-chlorophenyl)-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide (PubChem CID 173275535) has the molecular formula C16H13ClN4O3S and a molecular weight of 376.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 173275535 |
| Molecular Formula | C16H13ClN4O3S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 4-(4-chlorophenyl)-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide |
| SMILES | NC(=O)n1cc(-c2ccc(Cl)cc2)c(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C16H13ClN4O3S/c17-12-5-1-10(2-6-12)14-9-21(16(18)22)20-15(14)11-3-7-13(8-4-11)25(19,23)24/h1-9H,(H2,18,22)(H2,19,23,24) |
| InChIKey | ZAARMWJXLYZBPI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |