C17H13FN3O4S- — CID 18914552
2-[4-(4-fluorophenyl)-3-(4-sulfamoylphenyl)pyrazol-1-yl]acetate (PubChem CID 18914552) has the molecular formula C17H13FN3O4S- and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-3-(4-sulfamoylphenyl)pyrazol-1-yl]acetate.
| Compound Name | 2-[4-(4-fluorophenyl)-3-(4-sulfamoylphenyl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 18914552 |
| Molecular Formula | C17H13FN3O4S- |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-3-(4-sulfamoylphenyl)pyrazol-1-yl]acetate |
| SMILES | NS(=O)(=O)c1ccc(-c2nn(CC(=O)[O-])cc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H14FN3O4S/c18-13-5-1-11(2-6-13)15-9-21(10-16(22)23)20-17(15)12-3-7-14(8-4-12)26(19,24)25/h1-9H,10H2,(H,22,23)(H2,19,24,25)/p-1 |
| InChIKey | YPMWTUQYYRTAJE-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |