C18H15FN2O4S — CID 67644928
[4-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)pyrazol-1-yl] acetate (PubChem CID 67644928) has the molecular formula C18H15FN2O4S and a molecular weight of 374.39 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)pyrazol-1-yl] acetate.
| Compound Name | [4-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)pyrazol-1-yl] acetate |
|---|---|
| PubChem CID | 67644928 |
| Molecular Formula | C18H15FN2O4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [4-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)pyrazol-1-yl] acetate |
| SMILES | CC(=O)On1cc(-c2ccc(F)cc2)c(-c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C18H15FN2O4S/c1-12(22)25-21-11-17(13-3-7-15(19)8-4-13)18(20-21)14-5-9-16(10-6-14)26(2,23)24/h3-11H,1-2H3 |
| InChIKey | JWXYXVREMREXSA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |