About 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide
4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide (PubChem CID 173275897) has the molecular formula C18H17ClN4O3S
and a molecular weight of 404.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide |
| PubChem CID | 173275897 |
| Molecular Formula | C18H17ClN4O3S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide |
| SMILES | CN(C)C(=O)n1cc(-c2ccc(Cl)cc2)c(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C18H17ClN4O3S/c1-22(2)18(24)23-11-16(12-3-7-14(19)8-4-12)17(21-23)13-5-9-15(10-6-13)27(20,25)26/h3-11H,1-2H3,(H2,20,25,26) |
| InChIKey | SNJWGDLHLTZVRL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide?
The IUPAC name of 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide (CID 173275897) is 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide.
What is the SMILES notation for 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide?
The canonical SMILES for 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide is CN(C)C(=O)n1cc(-c2ccc(Cl)cc2)c(-c2ccc(S(N)(=O)=O)cc2)n1.
What is the InChIKey of 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide?
The InChIKey is SNJWGDLHLTZVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN4O3S/c1-22(2)18(24)23-11-16(12-3-7-14(19)8-4-12)17(21-23)13-5-9-15(10-6-13)27(20,25)26/h3-11H,1-2H3,(H2,20,25,26).
What are the key properties of 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide?
4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide has a molecular weight of 404.88 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-N,N-dimethyl-3-(4-sulfamoylphenyl)pyrazole-1-carboxamide is sourced from PubChem (CID 173275897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).