C20H19ClN4O3S3 — CID 87974182
3-[4-(4-chlorophenyl)-3-(4-sulfamoylphenyl)pyrazol-1-yl]prop-2-enyl N-hydroxy-N-methylcarbamodithioate (PubChem CID 87974182) has the molecular formula C20H19ClN4O3S3 and a molecular weight of 495.05 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-3-(4-sulfamoylphenyl)pyrazol-1-yl]prop-2-enyl N-hydroxy-N-methylcarbamodithioate.
| Compound Name | 3-[4-(4-chlorophenyl)-3-(4-sulfamoylphenyl)pyrazol-1-yl]prop-2-enyl N-hydroxy-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 87974182 |
| Molecular Formula | C20H19ClN4O3S3 |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-3-(4-sulfamoylphenyl)pyrazol-1-yl]prop-2-enyl N-hydroxy-N-methylcarbamodithioate |
| SMILES | CN(O)C(=S)SCC=Cn1cc(-c2ccc(Cl)cc2)c(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C20H19ClN4O3S3/c1-24(26)20(29)30-12-2-11-25-13-18(14-3-7-16(21)8-4-14)19(23-25)15-5-9-17(10-6-15)31(22,27)28/h2-11,13,26H,12H2,1H3,(H2,22,27,28) |
| InChIKey | ZSDIOMGAYVBWKR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|