C20H18N4O3S3 — CID 22505671
3-[4-phenyl-3-(4-sulfamoylphenyl)pyrazol-1-yl]prop-2-ynyl N-hydroxy-N-methylcarbamodithioate (PubChem CID 22505671) has the molecular formula C20H18N4O3S3 and a molecular weight of 458.59 g/mol. Its IUPAC name is 3-[4-phenyl-3-(4-sulfamoylphenyl)pyrazol-1-yl]prop-2-ynyl N-hydroxy-N-methylcarbamodithioate.
| Compound Name | 3-[4-phenyl-3-(4-sulfamoylphenyl)pyrazol-1-yl]prop-2-ynyl N-hydroxy-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 22505671 |
| Molecular Formula | C20H18N4O3S3 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 3-[4-phenyl-3-(4-sulfamoylphenyl)pyrazol-1-yl]prop-2-ynyl N-hydroxy-N-methylcarbamodithioate |
| SMILES | CN(O)C(=S)SCC#Cn1cc(-c2ccccc2)c(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C20H18N4O3S3/c1-23(25)20(28)29-13-5-12-24-14-18(15-6-3-2-4-7-15)19(22-24)16-8-10-17(11-9-16)30(21,26)27/h2-4,6-11,14,25H,13H2,1H3,(H2,21,26,27) |
| InChIKey | QEOVJAFHNHUSBT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|