C19H14N4O4S2 — CID 121461673
2-[3-phenyl-4-(4-sulfamoylphenyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 121461673) has the molecular formula C19H14N4O4S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-[3-phenyl-4-(4-sulfamoylphenyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-phenyl-4-(4-sulfamoylphenyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 121461673 |
| Molecular Formula | C19H14N4O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2-[3-phenyl-4-(4-sulfamoylphenyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2cn(-c3nc(C(=O)O)cs3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H14N4O4S2/c20-29(26,27)14-8-6-12(7-9-14)15-10-23(19-21-16(11-28-19)18(24)25)22-17(15)13-4-2-1-3-5-13/h1-11H,(H,24,25)(H2,20,26,27) |
| InChIKey | CRUZSPRHPAENJW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |