C20H15N5O3S2 — CID 156568292
2-[4-[(4-aminosulfanylbenzoyl)amino]-3-phenylpyrazol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 156568292) has the molecular formula C20H15N5O3S2 and a molecular weight of 437.51 g/mol. Its IUPAC name is 2-[4-[(4-aminosulfanylbenzoyl)amino]-3-phenylpyrazol-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-[(4-aminosulfanylbenzoyl)amino]-3-phenylpyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 156568292 |
| Molecular Formula | C20H15N5O3S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-[4-[(4-aminosulfanylbenzoyl)amino]-3-phenylpyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | NSc1ccc(C(=O)Nc2cn(-c3nc(C(=O)O)cs3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15N5O3S2/c21-30-14-8-6-13(7-9-14)18(26)22-15-10-25(20-23-16(11-29-20)19(27)28)24-17(15)12-4-2-1-3-5-12/h1-11H,21H2,(H,22,26)(H,27,28) |
| InChIKey | AGXAJKMSCVDANP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|