C23H15N3O2S — CID 59179873
2-(3,6-diphenylindazol-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 59179873) has the molecular formula C23H15N3O2S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-(3,6-diphenylindazol-1-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(3,6-diphenylindazol-1-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 59179873 |
| Molecular Formula | C23H15N3O2S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-(3,6-diphenylindazol-1-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-n2nc(-c3ccccc3)c3ccc(-c4ccccc4)cc32)n1 |
| InChI | InChI=1S/C23H15N3O2S/c27-22(28)19-14-29-23(24-19)26-20-13-17(15-7-3-1-4-8-15)11-12-18(20)21(25-26)16-9-5-2-6-10-16/h1-14H,(H,27,28) |
| InChIKey | NBTNNIFZJHACLV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |