About ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate
ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 67059782) has the molecular formula C24H24N4O3S
and a molecular weight of 448.55 g/mol. Its IUPAC name is ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 67059782 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-n2nc(-c3ccccc3)c3ccc(NC(=O)C(C)(C)C)cc32)n1 |
| InChI | InChI=1S/C24H24N4O3S/c1-5-31-21(29)18-14-32-23(26-18)28-19-13-16(25-22(30)24(2,3)4)11-12-17(19)20(27-28)15-9-7-6-8-10-15/h6-14H,5H2,1-4H3,(H,25,30) |
| InChIKey | XDIQFMNMTHXBJK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate (CID 67059782) is ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(-n2nc(-c3ccccc3)c3ccc(NC(=O)C(C)(C)C)cc32)n1.
What is the InChIKey of ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate?
The InChIKey is XDIQFMNMTHXBJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O3S/c1-5-31-21(29)18-14-32-23(26-18)28-19-13-16(25-22(30)24(2,3)4)11-12-17(19)20(27-28)15-9-7-6-8-10-15/h6-14H,5H2,1-4H3,(H,25,30).
What are the key properties of ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate?
ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate has a molecular weight of 448.55 g/mol, XLogP of 5.31, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[6-(2,2-dimethylpropanoylamino)-3-phenylindazol-1-yl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 67059782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).