C22H20N4O2S — CID 67071978
ethyl 2-[5-(4-aminophenyl)-4-methyl-3-phenylpyrazol-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 67071978) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is ethyl 2-[5-(4-aminophenyl)-4-methyl-3-phenylpyrazol-1-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[5-(4-aminophenyl)-4-methyl-3-phenylpyrazol-1-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 67071978 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | ethyl 2-[5-(4-aminophenyl)-4-methyl-3-phenylpyrazol-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-n2nc(-c3ccccc3)c(C)c2-c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C22H20N4O2S/c1-3-28-21(27)18-13-29-22(24-18)26-20(16-9-11-17(23)12-10-16)14(2)19(25-26)15-7-5-4-6-8-15/h4-13H,3,23H2,1-2H3 |
| InChIKey | DNWWWVGPRCSDAC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|