About 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid
2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 59179260) has the molecular formula C19H14N4O2S
and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 59179260 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | Nc1c(-c2ccccc2)nn(-c2nc(C(=O)O)cs2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H14N4O2S/c20-15-16(12-7-3-1-4-8-12)22-23(17(15)13-9-5-2-6-10-13)19-21-14(11-26-19)18(24)25/h1-11H,20H2,(H,24,25) |
| InChIKey | YIJWSWGNFRVEHD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid (CID 59179260) is 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid is Nc1c(-c2ccccc2)nn(-c2nc(C(=O)O)cs2)c1-c1ccccc1.
What is the InChIKey of 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is YIJWSWGNFRVEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O2S/c20-15-16(12-7-3-1-4-8-12)22-23(17(15)13-9-5-2-6-10-13)19-21-14(11-26-19)18(24)25/h1-11H,20H2,(H,24,25).
What are the key properties of 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid?
2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 362.41 g/mol, XLogP of 3.94, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 59179260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).