C19H13N3O3S — CID 44611631
2-(4-hydroxy-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 44611631) has the molecular formula C19H13N3O3S and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(4-hydroxy-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 44611631 |
| Molecular Formula | C19H13N3O3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-(4-hydroxy-3,5-diphenylpyrazol-1-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-n2nc(-c3ccccc3)c(O)c2-c2ccccc2)n1 |
| InChI | InChI=1S/C19H13N3O3S/c23-17-15(12-7-3-1-4-8-12)21-22(16(17)13-9-5-2-6-10-13)19-20-14(11-26-19)18(24)25/h1-11,23H,(H,24,25) |
| InChIKey | RMIFJFCVPBUPGD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |