C25H26N4O4S2 — CID 162332612
CID 162332612 (PubChem CID 162332612) has the molecular formula C25H26N4O4S2 and a molecular weight of 510.64 g/mol.
| Compound Name | CID 162332612 |
|---|---|
| PubChem CID | 162332612 |
| Molecular Formula | C25H26N4O4S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1csc(-n2nc(-c3ccccc3)c(Cc3ccc([SH+](=O)[O-])cc3)c2C2CC2)n1.N |
| InChI | InChI=1S/C25H23N3O4S2.H3N/c1-2-32-24(29)21-15-33-25(26-21)28-23(18-10-11-18)20(22(27-28)17-6-4-3-5-7-17)14-16-8-12-19(13-9-16)34(30)31;/h3-9,12-13,15,18,34H,2,10-11,14H2,1H3;1H3 |
| InChIKey | AJKAYOXHKVIICK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|