C33H33FN4O4S2 — CID 162309654
CID 162309654 (PubChem CID 162309654) has the molecular formula C33H33FN4O4S2 and a molecular weight of 632.78 g/mol.
| Compound Name | CID 162309654 |
|---|---|
| PubChem CID | 162309654 |
| Molecular Formula | C33H33FN4O4S2 |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1csc(-n2nc(-c3cccc(-c4ccc(C)cc4)c3)c(Cc3ccc([SH+](=O)[O-])cc3F)c2CC2CC2)n1.N |
| InChI | InChI=1S/C33H30FN3O4S2.H3N/c1-3-41-32(38)29-19-42-33(35-29)37-30(15-21-9-10-21)27(17-24-13-14-26(43(39)40)18-28(24)34)31(36-37)25-6-4-5-23(16-25)22-11-7-20(2)8-12-22;/h4-8,11-14,16,18-19,21,43H,3,9-10,15,17H2,1-2H3;1H3 |
| InChIKey | FLBTXPOXTIUPCK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|