About CID 162309654
CID 162309654 (PubChem CID 162309654) has the molecular formula C33H33FN4O4S2
and a molecular weight of 632.78 g/mol.
Molecular Properties
| Compound Name | CID 162309654 |
| PubChem CID | 162309654 |
| Molecular Formula | C33H33FN4O4S2 |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1csc(-n2nc(-c3cccc(-c4ccc(C)cc4)c3)c(Cc3ccc([SH+](=O)[O-])cc3F)c2CC2CC2)n1.N |
| InChI | InChI=1S/C33H30FN3O4S2.H3N/c1-3-41-32(38)29-19-42-33(35-29)37-30(15-21-9-10-21)27(17-24-13-14-26(43(39)40)18-28(24)34)31(36-37)25-6-4-5-23(16-25)22-11-7-20(2)8-12-22;/h4-8,11-14,16,18-19,21,43H,3,9-10,15,17H2,1-2H3;1H3 |
| InChIKey | FLBTXPOXTIUPCK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 162309654 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162309654?
The IUPAC name of CID 162309654 (CID 162309654) is not available.
What is the SMILES notation for CID 162309654?
The canonical SMILES for CID 162309654 is CCOC(=O)c1csc(-n2nc(-c3cccc(-c4ccc(C)cc4)c3)c(Cc3ccc([SH+](=O)[O-])cc3F)c2CC2CC2)n1.N.
What is the InChIKey of CID 162309654?
The InChIKey is FLBTXPOXTIUPCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H30FN3O4S2.H3N/c1-3-41-32(38)29-19-42-33(35-29)37-30(15-21-9-10-21)27(17-24-13-14-26(43(39)40)18-28(24)34)31(36-37)25-6-4-5-23(16-25)22-11-7-20(2)8-12-22;/h4-8,11-14,16,18-19,21,43H,3,9-10,15,17H2,1-2H3;1H3.
What are the key properties of CID 162309654?
CID 162309654 has a molecular weight of 632.78 g/mol, XLogP of 7.18, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162309654 is sourced from PubChem (CID 162309654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).