C31H25FN3O4S2- — CID 139318955
4-[[5-cyclopropyl-1-(4-ethoxycarbonyl-1,3-thiazol-2-yl)-3-(3-phenylphenyl)pyrazol-4-yl]methyl]-3-fluorobenzenesulfinate (PubChem CID 139318955) has the molecular formula C31H25FN3O4S2- and a molecular weight of 586.69 g/mol. Its IUPAC name is 4-[[5-cyclopropyl-1-(4-ethoxycarbonyl-1,3-thiazol-2-yl)-3-(3-phenylphenyl)pyrazol-4-yl]methyl]-3-fluorobenzenesulfinate.
| Compound Name | 4-[[5-cyclopropyl-1-(4-ethoxycarbonyl-1,3-thiazol-2-yl)-3-(3-phenylphenyl)pyrazol-4-yl]methyl]-3-fluorobenzenesulfinate |
|---|---|
| PubChem CID | 139318955 |
| Molecular Formula | C31H25FN3O4S2- |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | 4-[[5-cyclopropyl-1-(4-ethoxycarbonyl-1,3-thiazol-2-yl)-3-(3-phenylphenyl)pyrazol-4-yl]methyl]-3-fluorobenzenesulfinate |
| SMILES | CCOC(=O)c1csc(-n2nc(-c3cccc(-c4ccccc4)c3)c(Cc3ccc(S(=O)[O-])cc3F)c2C2CC2)n1 |
| InChI | InChI=1S/C31H26FN3O4S2/c1-2-39-30(36)27-18-40-31(33-27)35-29(20-11-12-20)25(16-22-13-14-24(41(37)38)17-26(22)32)28(34-35)23-10-6-9-21(15-23)19-7-4-3-5-8-19/h3-10,13-15,17-18,20H,2,11-12,16H2,1H3,(H,37,38)/p-1 |
| InChIKey | FGFLZKRZAGSWRU-UHFFFAOYSA-M |
| XLogP | 6.68 |
| TPSA | 97.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|