C31H26FN3O4S2 — CID 140913306
CID 140913306 (PubChem CID 140913306) has the molecular formula C31H26FN3O4S2 and a molecular weight of 587.70 g/mol.
| Compound Name | CID 140913306 |
|---|---|
| PubChem CID | 140913306 |
| Molecular Formula | C31H26FN3O4S2 |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1csc(-n2nc(-c3cccc(-c4ccccc4)c3)c(Cc3ccc([SH+](=O)[O-])cc3F)c2C2CC2)n1 |
| InChI | InChI=1S/C31H26FN3O4S2/c1-2-39-30(36)27-18-40-31(33-27)35-29(20-11-12-20)25(16-22-13-14-24(41(37)38)17-26(22)32)28(34-35)23-10-6-9-21(15-23)19-7-4-3-5-8-19/h3-10,13-15,17-18,20,41H,2,11-12,16H2,1H3 |
| InChIKey | JINXTYNMYVNNPB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 97.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|