About CID 140913261
CID 140913261 (PubChem CID 140913261) has the molecular formula C29H23F2N4O3S2+
and a molecular weight of 577.66 g/mol.
Molecular Properties
| Compound Name | CID 140913261 |
| PubChem CID | 140913261 |
| Molecular Formula | C29H23F2N4O3S2+ |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | — |
| SMILES | N[SH+](=O)c1ccc(Cc2c(-c3cccc(-c4ccc(F)cc4)c3)nn(-c3nc(C(=O)O)cs3)c2C2CC2)cc1F |
| InChI | InChI=1S/C29H22F2N4O3S2/c30-21-9-7-17(8-10-21)19-2-1-3-20(14-19)26-22(12-16-4-11-25(40(32)38)23(31)13-16)27(18-5-6-18)35(34-26)29-33-24(15-39-29)28(36)37/h1-4,7-11,13-15,18H,5-6,12H2,(H2,32,38)(H,36,37)/p+1 |
| InChIKey | VWSSYXSJPDRSPU-UHFFFAOYSA-O |
| XLogP | 6.04 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 140913261 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140913261?
The IUPAC name of CID 140913261 (CID 140913261) is not available.
What is the SMILES notation for CID 140913261?
The canonical SMILES for CID 140913261 is N[SH+](=O)c1ccc(Cc2c(-c3cccc(-c4ccc(F)cc4)c3)nn(-c3nc(C(=O)O)cs3)c2C2CC2)cc1F.
What is the InChIKey of CID 140913261?
The InChIKey is VWSSYXSJPDRSPU-UHFFFAOYSA-O. The full InChI is InChI=1S/C29H22F2N4O3S2/c30-21-9-7-17(8-10-21)19-2-1-3-20(14-19)26-22(12-16-4-11-25(40(32)38)23(31)13-16)27(18-5-6-18)35(34-26)29-33-24(15-39-29)28(36)37/h1-4,7-11,13-15,18H,5-6,12H2,(H2,32,38)(H,36,37)/p+1.
What are the key properties of CID 140913261?
CID 140913261 has a molecular weight of 577.66 g/mol, XLogP of 6.04, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140913261 is sourced from PubChem (CID 140913261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).