C29H26F2N4O4S2 — CID 162320433
CID 162320433 (PubChem CID 162320433) has the molecular formula C29H26F2N4O4S2 and a molecular weight of 596.68 g/mol.
| Compound Name | CID 162320433 |
|---|---|
| PubChem CID | 162320433 |
| Molecular Formula | C29H26F2N4O4S2 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | — |
| SMILES | N[SH+](=O)c1ccc(Cc2c(-c3ccc(F)c(C#CC4CC4)c3)nn(-c3nc(C(=O)O)cs3)c2CC2CC2)cc1F.[OH-] |
| InChI | InChI=1S/C29H24F2N4O3S2.H2O/c30-22-9-8-20(14-19(22)7-5-16-1-2-16)27-21(11-18-6-10-26(40(32)38)23(31)12-18)25(13-17-3-4-17)35(34-27)29-33-24(15-39-29)28(36)37;/h6,8-10,12,14-17H,1-4,11,13H2,(H2,32,38)(H,36,37);1H2 |
| InChIKey | BTQCPIVMMFVFAB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|