C32H27F2N4O3S3+ — CID 153429439
2-(5-(2-cyclopropylethyl)-3-(4-fluoro-3-((5-methylthiophen-2-yl) ethynyl)phenyl)-4-(3-fluoro-4-sulfamoylbenzyl)-1H-pyrazol-1-yl)thiazole-4-carboxylic acid (PubChem CID 153429439) has the molecular formula C32H27F2N4O3S3+ and a molecular weight of 649.79 g/mol.
| Compound Name | 2-(5-(2-cyclopropylethyl)-3-(4-fluoro-3-((5-methylthiophen-2-yl) ethynyl)phenyl)-4-(3-fluoro-4-sulfamoylbenzyl)-1H-pyrazol-1-yl)thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 153429439 |
| Molecular Formula | C32H27F2N4O3S3+ |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C#Cc2cc(-c3nn(-c4nc(C(=O)O)cs4)c(CCC4CC4)c3Cc3ccc([SH+](N)=O)c(F)c3)ccc2F)s1 |
| InChI | InChI=1S/C32H26F2N4O3S3/c1-18-2-9-23(43-18)10-7-21-16-22(8-11-25(21)33)30-24(14-20-6-13-29(44(35)41)26(34)15-20)28(12-5-19-3-4-19)38(37-30)32-36-27(17-42-32)31(39)40/h2,6,8-9,11,13,15-17,19H,3-5,12,14H2,1H3,(H2,35,41)(H,39,40)/p+1 |
| InChIKey | GVXDWDNUGQWOBG-UHFFFAOYSA-O |
| XLogP | 6.60 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|