About CID 140913229
CID 140913229 (PubChem CID 140913229) has the molecular formula C27H25F2N4O3S2+
and a molecular weight of 555.65 g/mol.
Molecular Properties
| Compound Name | CID 140913229 |
| PubChem CID | 140913229 |
| Molecular Formula | C27H25F2N4O3S2+ |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | — |
| SMILES | C=C(C)c1cc(-c2nn(-c3nc(C(=O)O)cs3)c(CC3CC3)c2Cc2ccc([SH+](N)=O)c(F)c2)ccc1F |
| InChI | InChI=1S/C27H24F2N4O3S2/c1-14(2)18-12-17(6-7-20(18)28)25-19(9-16-5-8-24(38(30)36)21(29)10-16)23(11-15-3-4-15)33(32-25)27-31-22(13-37-27)26(34)35/h5-8,10,12-13,15H,1,3-4,9,11H2,2H3,(H2,30,36)(H,34,35)/p+1 |
| InChIKey | SDTPNDKWODALAF-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 140913229 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140913229?
The IUPAC name of CID 140913229 (CID 140913229) is not available.
What is the SMILES notation for CID 140913229?
The canonical SMILES for CID 140913229 is C=C(C)c1cc(-c2nn(-c3nc(C(=O)O)cs3)c(CC3CC3)c2Cc2ccc([SH+](N)=O)c(F)c2)ccc1F.
What is the InChIKey of CID 140913229?
The InChIKey is SDTPNDKWODALAF-UHFFFAOYSA-O. The full InChI is InChI=1S/C27H24F2N4O3S2/c1-14(2)18-12-17(6-7-20(18)28)25-19(9-16-5-8-24(38(30)36)21(29)10-16)23(11-15-3-4-15)33(32-25)27-31-22(13-37-27)26(34)35/h5-8,10,12-13,15H,1,3-4,9,11H2,2H3,(H2,30,36)(H,34,35)/p+1.
What are the key properties of CID 140913229?
CID 140913229 has a molecular weight of 555.65 g/mol, XLogP of 5.48, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140913229 is sourced from PubChem (CID 140913229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).