C27H25F2N4O3S2+ — CID 140913229
CID 140913229 (PubChem CID 140913229) has the molecular formula C27H25F2N4O3S2+ and a molecular weight of 555.65 g/mol.
| Compound Name | CID 140913229 |
|---|---|
| PubChem CID | 140913229 |
| Molecular Formula | C27H25F2N4O3S2+ |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | — |
| SMILES | C=C(C)c1cc(-c2nn(-c3nc(C(=O)O)cs3)c(CC3CC3)c2Cc2ccc([SH+](N)=O)c(F)c2)ccc1F |
| InChI | InChI=1S/C27H24F2N4O3S2/c1-14(2)18-12-17(6-7-20(18)28)25-19(9-16-5-8-24(38(30)36)21(29)10-16)23(11-15-3-4-15)33(32-25)27-31-22(13-37-27)26(34)35/h5-8,10,12-13,15H,1,3-4,9,11H2,2H3,(H2,30,36)(H,34,35)/p+1 |
| InChIKey | SDTPNDKWODALAF-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|