C29H25F2N4O3S3+ — CID 145116580
CID 145116580 (PubChem CID 145116580) has the molecular formula C29H25F2N4O3S3+ and a molecular weight of 611.74 g/mol.
| Compound Name | CID 145116580 |
|---|---|
| PubChem CID | 145116580 |
| Molecular Formula | C29H25F2N4O3S3+ |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2cc(-c3nn(-c4nc(C(=O)O)cs4)c(CC4CC4)c3Cc3ccc([SH+](N)=O)c(F)c3)ccc2F)s1 |
| InChI | InChI=1S/C29H24F2N4O3S3/c1-15-2-8-25(40-15)19-13-18(6-7-21(19)30)27-20(10-17-5-9-26(41(32)38)22(31)11-17)24(12-16-3-4-16)35(34-27)29-33-23(14-39-29)28(36)37/h2,5-9,11,13-14,16H,3-4,10,12H2,1H3,(H2,32,38)(H,36,37)/p+1 |
| InChIKey | VENZPSYKCCIMJS-UHFFFAOYSA-O |
| XLogP | 6.48 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|