C29H26F2N4O6S2 — CID 162307724
CID 162307724 (PubChem CID 162307724) has the molecular formula C29H26F2N4O6S2 and a molecular weight of 628.68 g/mol.
| Compound Name | CID 162307724 |
|---|---|
| PubChem CID | 162307724 |
| Molecular Formula | C29H26F2N4O6S2 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.13 |
| IUPAC Name | — |
| SMILES | N[SH+](=O)c1ccc(Cc2c(-c3ccc(F)c(C#CC4(O)COC4)c3)nn(-c3nc(C(=O)O)cs3)c2CC2CC2)cc1F.[OH-] |
| InChI | InChI=1S/C29H24F2N4O5S2.H2O/c30-21-5-4-19(12-18(21)7-8-29(38)14-40-15-29)26-20(9-17-3-6-25(42(32)39)22(31)10-17)24(11-16-1-2-16)35(34-26)28-33-23(13-41-28)27(36)37;/h3-6,10,12-13,16,38H,1-2,9,11,14-15H2,(H2,32,39)(H,36,37);1H2 |
| InChIKey | GIQNHAMIYVJVAJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 170.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|