C28H23F3N4O4S3 — CID 162304859
CID 162304859 (PubChem CID 162304859) has the molecular formula C28H23F3N4O4S3 and a molecular weight of 632.71 g/mol.
| Compound Name | CID 162304859 |
|---|---|
| PubChem CID | 162304859 |
| Molecular Formula | C28H23F3N4O4S3 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | — |
| SMILES | N[SH+](=O)c1ccc(Cc2c(-c3ccc(F)c(-c4ccc(F)s4)c3)nn(-c3nc(C(=O)O)cs3)c2CC2CC2)cc1F.[OH-] |
| InChI | InChI=1S/C28H21F3N4O3S3.H2O/c29-19-5-4-16(12-17(19)23-6-8-25(31)40-23)26-18(9-15-3-7-24(41(32)38)20(30)10-15)22(11-14-1-2-14)35(34-26)28-33-21(13-39-28)27(36)37;/h3-8,10,12-14H,1-2,9,11H2,(H2,32,38)(H,36,37);1H2 |
| InChIKey | JRLAFMXLAUUIAK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|