About CID 140913159
CID 140913159 (PubChem CID 140913159) has the molecular formula C30H25F2N4O3S2+
and a molecular weight of 591.69 g/mol.
Molecular Properties
| Compound Name | CID 140913159 |
| PubChem CID | 140913159 |
| Molecular Formula | C30H25F2N4O3S2+ |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2cc(-c3nn(-c4nc(C(=O)O)cs4)c(C4CC4)c3Cc3ccc([SH+](N)=O)cc3F)ccc2F)cc1 |
| InChI | InChI=1S/C30H24F2N4O3S2/c1-16-2-4-17(5-3-16)22-13-20(9-11-24(22)31)27-23(12-19-8-10-21(41(33)39)14-25(19)32)28(18-6-7-18)36(35-27)30-34-26(15-40-30)29(37)38/h2-5,8-11,13-15,18H,6-7,12H2,1H3,(H2,33,39)(H,37,38)/p+1 |
| InChIKey | BXJLQKBSVLICIV-UHFFFAOYSA-O |
| XLogP | 6.34 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 140913159 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140913159?
The IUPAC name of CID 140913159 (CID 140913159) is not available.
What is the SMILES notation for CID 140913159?
The canonical SMILES for CID 140913159 is Cc1ccc(-c2cc(-c3nn(-c4nc(C(=O)O)cs4)c(C4CC4)c3Cc3ccc([SH+](N)=O)cc3F)ccc2F)cc1.
What is the InChIKey of CID 140913159?
The InChIKey is BXJLQKBSVLICIV-UHFFFAOYSA-O. The full InChI is InChI=1S/C30H24F2N4O3S2/c1-16-2-4-17(5-3-16)22-13-20(9-11-24(22)31)27-23(12-19-8-10-21(41(33)39)14-25(19)32)28(18-6-7-18)36(35-27)30-34-26(15-40-30)29(37)38/h2-5,8-11,13-15,18H,6-7,12H2,1H3,(H2,33,39)(H,37,38)/p+1.
What are the key properties of CID 140913159?
CID 140913159 has a molecular weight of 591.69 g/mol, XLogP of 6.34, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140913159 is sourced from PubChem (CID 140913159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).