C30H25F2N4O3S2+ — CID 140913159
CID 140913159 (PubChem CID 140913159) has the molecular formula C30H25F2N4O3S2+ and a molecular weight of 591.69 g/mol.
| Compound Name | CID 140913159 |
|---|---|
| PubChem CID | 140913159 |
| Molecular Formula | C30H25F2N4O3S2+ |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2cc(-c3nn(-c4nc(C(=O)O)cs4)c(C4CC4)c3Cc3ccc([SH+](N)=O)cc3F)ccc2F)cc1 |
| InChI | InChI=1S/C30H24F2N4O3S2/c1-16-2-4-17(5-3-16)22-13-20(9-11-24(22)31)27-23(12-19-8-10-21(41(33)39)14-25(19)32)28(18-6-7-18)36(35-27)30-34-26(15-40-30)29(37)38/h2-5,8-11,13-15,18H,6-7,12H2,1H3,(H2,33,39)(H,37,38)/p+1 |
| InChIKey | BXJLQKBSVLICIV-UHFFFAOYSA-O |
| XLogP | 6.34 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|