C31H28FN4O4S2+ — CID 140913316
CID 140913316 (PubChem CID 140913316) has the molecular formula C31H28FN4O4S2+ and a molecular weight of 603.72 g/mol.
| Compound Name | CID 140913316 |
|---|---|
| PubChem CID | 140913316 |
| Molecular Formula | C31H28FN4O4S2+ |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | — |
| SMILES | N[SH+](=O)c1ccc(Cc2c(-c3cccc(OCc4ccccc4)c3)nn(-c3nc(C(=O)O)cs3)c2CC2CC2)c(F)c1 |
| InChI | InChI=1S/C31H27FN4O4S2/c32-26-16-24(42(33)39)12-11-21(26)15-25-28(13-19-9-10-19)36(31-34-27(18-41-31)30(37)38)35-29(25)22-7-4-8-23(14-22)40-17-20-5-2-1-3-6-20/h1-8,11-12,14,16,18-19H,9-10,13,15,17H2,(H2,33,39)(H,37,38)/p+1 |
| InChIKey | UAHZABTWSYSVSZ-UHFFFAOYSA-O |
| XLogP | 5.88 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|