C26H27N7OS — CID 24956610
2-(3-phenyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 24956610) has the molecular formula C26H27N7OS and a molecular weight of 485.62 g/mol. Its IUPAC name is 2-(3-phenyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3-phenyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 24956610 |
| Molecular Formula | C26H27N7OS |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-(3-phenyl-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCNCC1)c1csc(N2CCc3c(-c4ccccc4)n[nH]c3C2)n1 |
| InChI | InChI=1S/C26H27N7OS/c34-25(28-20-8-4-5-9-23(20)32-14-11-27-12-15-32)22-17-35-26(29-22)33-13-10-19-21(16-33)30-31-24(19)18-6-2-1-3-7-18/h1-9,17,27H,10-16H2,(H,28,34)(H,30,31) |
| InChIKey | POPMMZLODWKRQT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |