C21H23N5OS — CID 24967756
2-(benzylamino)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 24967756) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is 2-(benzylamino)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(benzylamino)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 24967756 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-(benzylamino)-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCNCC1)c1csc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C21H23N5OS/c27-20(18-15-28-21(25-18)23-14-16-6-2-1-3-7-16)24-17-8-4-5-9-19(17)26-12-10-22-11-13-26/h1-9,15,22H,10-14H2,(H,23,25)(H,24,27) |
| InChIKey | ZGVXYQMJVRHWPL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |