C20H18ClN3O4S3 — CID 87973347
3-[5-(4-chlorophenyl)-4-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]prop-2-enyl N-hydroxy-N-methylcarbamodithioate (PubChem CID 87973347) has the molecular formula C20H18ClN3O4S3 and a molecular weight of 496.04 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-4-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]prop-2-enyl N-hydroxy-N-methylcarbamodithioate.
| Compound Name | 3-[5-(4-chlorophenyl)-4-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]prop-2-enyl N-hydroxy-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 87973347 |
| Molecular Formula | C20H18ClN3O4S3 |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-4-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]prop-2-enyl N-hydroxy-N-methylcarbamodithioate |
| SMILES | CN(O)C(=S)SCC=Cc1nc(-c2ccc(S(N)(=O)=O)cc2)c(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H18ClN3O4S3/c1-24(25)20(29)30-12-2-3-17-23-18(13-6-10-16(11-7-13)31(22,26)27)19(28-17)14-4-8-15(21)9-5-14/h2-11,25H,12H2,1H3,(H2,22,26,27) |
| InChIKey | ZTQYAQKDDGYRQU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|