C22H23FN2O5S3 — CID 22505606
3-[4-(3-fluoro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)furan-2-yl]propyl N-hydroxy-N-methylcarbamodithioate (PubChem CID 22505606) has the molecular formula C22H23FN2O5S3 and a molecular weight of 510.63 g/mol. Its IUPAC name is 3-[4-(3-fluoro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)furan-2-yl]propyl N-hydroxy-N-methylcarbamodithioate.
| Compound Name | 3-[4-(3-fluoro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)furan-2-yl]propyl N-hydroxy-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 22505606 |
| Molecular Formula | C22H23FN2O5S3 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 3-[4-(3-fluoro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)furan-2-yl]propyl N-hydroxy-N-methylcarbamodithioate |
| SMILES | COc1ccc(-c2cc(CCCSC(=S)N(C)O)oc2-c2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C22H23FN2O5S3/c1-25(26)22(31)32-11-3-4-16-13-18(15-7-10-20(29-2)19(23)12-15)21(30-16)14-5-8-17(9-6-14)33(24,27)28/h5-10,12-13,26H,3-4,11H2,1-2H3,(H2,24,27,28) |
| InChIKey | NUXXMSXVWIJREN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|