C18H17ClN4O6S — CID 87973340
1-[[4-(3-chloro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methyl]-1-hydroxyurea (PubChem CID 87973340) has the molecular formula C18H17ClN4O6S and a molecular weight of 452.88 g/mol. Its IUPAC name is 1-[[4-(3-chloro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[4-(3-chloro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 87973340 |
| Molecular Formula | C18H17ClN4O6S |
| Molecular Weight | 452.88 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 1-[[4-(3-chloro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methyl]-1-hydroxyurea |
| SMILES | COc1ccc(-c2nc(CN(O)C(N)=O)oc2-c2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C18H17ClN4O6S/c1-28-14-7-4-11(8-13(14)19)16-17(29-15(22-16)9-23(25)18(20)24)10-2-5-12(6-3-10)30(21,26)27/h2-8,25H,9H2,1H3,(H2,20,24)(H2,21,26,27) |
| InChIKey | QSXURUFHQIFDDJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.88 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|