About N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide
N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide (PubChem CID 22505629) has the molecular formula C18H17N3O6S
and a molecular weight of 403.42 g/mol. Its IUPAC name is N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide |
| PubChem CID | 22505629 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2nc(CC(=O)NO)oc2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O6S/c1-26-13-6-2-11(3-7-13)17-18(27-16(20-17)10-15(22)21-23)12-4-8-14(9-5-12)28(19,24)25/h2-9,23H,10H2,1H3,(H,21,22)(H2,19,24,25) |
| InChIKey | GMXDTPABMNNSOO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide?
The IUPAC name of N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide (CID 22505629) is N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide.
What is the SMILES notation for N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide?
The canonical SMILES for N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide is COc1ccc(-c2nc(CC(=O)NO)oc2-c2ccc(S(N)(=O)=O)cc2)cc1.
What is the InChIKey of N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide?
The InChIKey is GMXDTPABMNNSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O6S/c1-26-13-6-2-11(3-7-13)17-18(27-16(20-17)10-15(22)21-23)12-4-8-14(9-5-12)28(19,24)25/h2-9,23H,10H2,1H3,(H,21,22)(H2,19,24,25).
What are the key properties of N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide?
N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide has a molecular weight of 403.42 g/mol, XLogP of 1.71, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2-[4-(4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetamide is sourced from PubChem (CID 22505629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).