C17H13ClN2O5S — CID 11949254
2-[4-(4-chlorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetic acid (PubChem CID 11949254) has the molecular formula C17H13ClN2O5S and a molecular weight of 392.82 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetic acid.
| Compound Name | 2-[4-(4-chlorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 11949254 |
| Molecular Formula | C17H13ClN2O5S |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2oc(CC(=O)O)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H13ClN2O5S/c18-12-5-1-10(2-6-12)16-17(25-14(20-16)9-15(21)22)11-3-7-13(8-4-11)26(19,23)24/h1-8H,9H2,(H,21,22)(H2,19,23,24) |
| InChIKey | QMKKMUQGHGIESD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |