C19H17ClN2O5S — CID 22505648
2-[4-(4-chlorophenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide (PubChem CID 22505648) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 22505648 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide |
| SMILES | CN(O)C(=O)Cc1nc(-c2ccc(Cl)cc2)c(-c2ccc(S(C)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C19H17ClN2O5S/c1-22(24)17(23)11-16-21-18(12-3-7-14(20)8-4-12)19(27-16)13-5-9-15(10-6-13)28(2,25)26/h3-10,24H,11H2,1-2H3 |
| InChIKey | BFHSHMFMLXAJGQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|