C24H21NO3S — CID 18701525
4-(4-methylsulfonylphenyl)-5-phenyl-2-(2-phenylethyl)-1,3-oxazole (PubChem CID 18701525) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is 4-(4-methylsulfonylphenyl)-5-phenyl-2-(2-phenylethyl)-1,3-oxazole.
| Compound Name | 4-(4-methylsulfonylphenyl)-5-phenyl-2-(2-phenylethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 18701525 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-(4-methylsulfonylphenyl)-5-phenyl-2-(2-phenylethyl)-1,3-oxazole |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(CCc3ccccc3)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO3S/c1-29(26,27)21-15-13-19(14-16-21)23-24(20-10-6-3-7-11-20)28-22(25-23)17-12-18-8-4-2-5-9-18/h2-11,13-16H,12,17H2,1H3 |
| InChIKey | SBKYUUGDTLWSAU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |