C19H18ClN3O6S — CID 22505117
2-[4-(3-chloro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide (PubChem CID 22505117) has the molecular formula C19H18ClN3O6S and a molecular weight of 451.89 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide.
| Compound Name | 2-[4-(3-chloro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 22505117 |
| Molecular Formula | C19H18ClN3O6S |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 2-[4-(3-chloro-4-methoxyphenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide |
| SMILES | COc1ccc(-c2nc(CC(=O)N(C)O)oc2-c2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C19H18ClN3O6S/c1-23(25)17(24)10-16-22-18(12-5-8-15(28-2)14(20)9-12)19(29-16)11-3-6-13(7-4-11)30(21,26)27/h3-9,25H,10H2,1-2H3,(H2,21,26,27) |
| InChIKey | DUNDFGNHZMBJTP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|