C18H16ClN3O4S3 — CID 22505336
[4-(4-chlorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methyl N-hydroxy-N-methylcarbamodithioate (PubChem CID 22505336) has the molecular formula C18H16ClN3O4S3 and a molecular weight of 470.00 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methyl N-hydroxy-N-methylcarbamodithioate.
| Compound Name | [4-(4-chlorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methyl N-hydroxy-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 22505336 |
| Molecular Formula | C18H16ClN3O4S3 |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | [4-(4-chlorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methyl N-hydroxy-N-methylcarbamodithioate |
| SMILES | CN(O)C(=S)SCc1nc(-c2ccc(Cl)cc2)c(-c2ccc(S(N)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C18H16ClN3O4S3/c1-22(23)18(27)28-10-15-21-16(11-2-6-13(19)7-3-11)17(26-15)12-4-8-14(9-5-12)29(20,24)25/h2-9,23H,10H2,1H3,(H2,20,24,25) |
| InChIKey | JTGNQJRNKHYKLZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|