C17H14FN3O5S — CID 22505621
2-[4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxyacetamide (PubChem CID 22505621) has the molecular formula C17H14FN3O5S and a molecular weight of 391.38 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxyacetamide.
| Compound Name | 2-[4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 22505621 |
| Molecular Formula | C17H14FN3O5S |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxyacetamide |
| SMILES | NS(=O)(=O)c1ccc(-c2oc(CC(=O)NO)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H14FN3O5S/c18-12-5-1-10(2-6-12)16-17(26-15(20-16)9-14(22)21-23)11-3-7-13(8-4-11)27(19,24)25/h1-8,23H,9H2,(H,21,22)(H2,19,24,25) |
| InChIKey | GFXYXJQHRQXKAD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|