C17H15FN2O3S — CID 67621648
4-[2-ethyl-4-(3-fluorophenyl)-1,3-oxazol-5-yl]benzenesulfonamide (PubChem CID 67621648) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-[2-ethyl-4-(3-fluorophenyl)-1,3-oxazol-5-yl]benzenesulfonamide.
| Compound Name | 4-[2-ethyl-4-(3-fluorophenyl)-1,3-oxazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67621648 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-[2-ethyl-4-(3-fluorophenyl)-1,3-oxazol-5-yl]benzenesulfonamide |
| SMILES | CCc1nc(-c2cccc(F)c2)c(-c2ccc(S(N)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C17H15FN2O3S/c1-2-15-20-16(12-4-3-5-13(18)10-12)17(23-15)11-6-8-14(9-7-11)24(19,21)22/h3-10H,2H2,1H3,(H2,19,21,22) |
| InChIKey | ZAJHKQHVGXHRNC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |