C16H15N2O6PS — CID 67772131
[4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methylphosphonic acid (PubChem CID 67772131) has the molecular formula C16H15N2O6PS and a molecular weight of 394.35 g/mol. Its IUPAC name is [4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methylphosphonic acid.
| Compound Name | [4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 67772131 |
| Molecular Formula | C16H15N2O6PS |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | [4-phenyl-5-(4-sulfamoylphenyl)-1,3-oxazol-2-yl]methylphosphonic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2oc(CP(=O)(O)O)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15N2O6PS/c17-26(22,23)13-8-6-12(7-9-13)16-15(11-4-2-1-3-5-11)18-14(24-16)10-25(19,20)21/h1-9H,10H2,(H2,17,22,23)(H2,19,20,21) |
| InChIKey | IOSACDQOGGMXFM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|