C22H17FN2O4S — CID 18701723
4-[2-[(4-fluorophenoxy)methyl]-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide (PubChem CID 18701723) has the molecular formula C22H17FN2O4S and a molecular weight of 424.45 g/mol. Its IUPAC name is 4-[2-[(4-fluorophenoxy)methyl]-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide.
| Compound Name | 4-[2-[(4-fluorophenoxy)methyl]-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18701723 |
| Molecular Formula | C22H17FN2O4S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 4-[2-[(4-fluorophenoxy)methyl]-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2oc(COc3ccc(F)cc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17FN2O4S/c23-17-8-10-18(11-9-17)28-14-20-25-21(15-4-2-1-3-5-15)22(29-20)16-6-12-19(13-7-16)30(24,26)27/h1-13H,14H2,(H2,24,26,27) |
| InChIKey | KGVPOEGXFLRJTR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |