C22H18N2O4S — CID 67622817
2-[2-(phenoxymethyl)-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide (PubChem CID 67622817) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[2-(phenoxymethyl)-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide.
| Compound Name | 2-[2-(phenoxymethyl)-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67622817 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2-[2-(phenoxymethyl)-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1oc(COc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H18N2O4S/c23-29(25,26)19-14-8-7-13-18(19)22-21(16-9-3-1-4-10-16)24-20(28-22)15-27-17-11-5-2-6-12-17/h1-14H,15H2,(H2,23,25,26) |
| InChIKey | PBMGQOIDOPKKBP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |