C20H21N3O6S — CID 22505474
N-hydroxy-3-[4-(4-methoxyphenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-methylpropanamide (PubChem CID 22505474) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is N-hydroxy-3-[4-(4-methoxyphenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-methylpropanamide.
| Compound Name | N-hydroxy-3-[4-(4-methoxyphenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 22505474 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-hydroxy-3-[4-(4-methoxyphenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-methylpropanamide |
| SMILES | COc1ccc(-c2nc(CCC(=O)N(C)O)oc2-c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21N3O6S/c1-23(25)18(24)12-11-17-22-19(13-7-9-14(28-2)10-8-13)20(29-17)15-5-3-4-6-16(15)30(21,26)27/h3-10,25H,11-12H2,1-2H3,(H2,21,26,27) |
| InChIKey | YNQSDDBNBPOOKV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|