C16H14N2O4S — CID 173207146
2-[4-(4-methoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide (PubChem CID 173207146) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide.
| Compound Name | 2-[4-(4-methoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 173207146 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2ncoc2-c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H14N2O4S/c1-21-12-8-6-11(7-9-12)15-16(22-10-18-15)13-4-2-3-5-14(13)23(17,19)20/h2-10H,1H3,(H2,17,19,20) |
| InChIKey | UZPRVZXZWHFWQG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |