C18H16ClN3O5S — CID 87974449
2-[4-(4-chlorophenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide (PubChem CID 87974449) has the molecular formula C18H16ClN3O5S and a molecular weight of 421.86 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 87974449 |
| Molecular Formula | C18H16ClN3O5S |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-5-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]-N-hydroxy-N-methylacetamide |
| SMILES | CN(O)C(=O)Cc1nc(-c2ccc(Cl)cc2)c(-c2ccccc2S(N)(=O)=O)o1 |
| InChI | InChI=1S/C18H16ClN3O5S/c1-22(24)16(23)10-15-21-17(11-6-8-12(19)9-7-11)18(27-15)13-4-2-3-5-14(13)28(20,25)26/h2-9,24H,10H2,1H3,(H2,20,25,26) |
| InChIKey | LRMJRDRPLQZEEF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|