C18H16N2O5S — CID 67623640
methyl 2-[5-phenyl-4-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]acetate (PubChem CID 67623640) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is methyl 2-[5-phenyl-4-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]acetate.
| Compound Name | methyl 2-[5-phenyl-4-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]acetate |
|---|---|
| PubChem CID | 67623640 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | methyl 2-[5-phenyl-4-(2-sulfamoylphenyl)-1,3-oxazol-2-yl]acetate |
| SMILES | COC(=O)Cc1nc(-c2ccccc2S(N)(=O)=O)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H16N2O5S/c1-24-16(21)11-15-20-17(18(25-15)12-7-3-2-4-8-12)13-9-5-6-10-14(13)26(19,22)23/h2-10H,11H2,1H3,(H2,19,22,23) |
| InChIKey | ONMIAMOYWVYJII-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |